C11H12NO7+ — CID 163781754
[(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-3-hydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-methylidyneazanium (PubChem CID 163781754) has the molecular formula C11H12NO7+ and a molecular weight of 270.22 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-3-hydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-methylidyneazanium.
| Compound Name | [(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-3-hydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-methylidyneazanium |
|---|---|
| PubChem CID | 163781754 |
| Molecular Formula | C11H12NO7+ |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [(3R,3aR,6R,6aR)-6-[(Z)-3-carboxyprop-2-enoyl]oxy-3-hydroxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-6a-yl]-methylidyneazanium |
| SMILES | C#[N+][C@]12OC[C@@H](O)[C@H]1OC[C@H]2OC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H11NO7/c1-12-11-7(19-9(16)3-2-8(14)15)5-17-10(11)6(13)4-18-11/h1-3,6-7,10,13H,4-5H2/p+1/b3-2-/t6-,7-,10-,11-/m1/s1 |
| InChIKey | VDVYMQVAZOHWNK-IWKDDTNXSA-O |
| XLogP | -1.01 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|