C16H19IN2O4S — CID 163782427
(2S)-3-[4-(2-tert-butyl-1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]-2-iodopropanamide (PubChem CID 163782427) has the molecular formula C16H19IN2O4S and a molecular weight of 462.31 g/mol. Its IUPAC name is (2S)-3-[4-(2-tert-butyl-1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]-2-iodopropanamide.
| Compound Name | (2S)-3-[4-(2-tert-butyl-1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]-2-iodopropanamide |
|---|---|
| PubChem CID | 163782427 |
| Molecular Formula | C16H19IN2O4S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | (2S)-3-[4-(2-tert-butyl-1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]-2-iodopropanamide |
| SMILES | CC(C)(C)N1C(=O)C=C(c2ccc(C[C@H](I)C(N)=O)cc2)S1(=O)=O |
| InChI | InChI=1S/C16H19IN2O4S/c1-16(2,3)19-14(20)9-13(24(19,22)23)11-6-4-10(5-7-11)8-12(17)15(18)21/h4-7,9,12H,8H2,1-3H3,(H2,18,21)/t12-/m0/s1 |
| InChIKey | MPRSQCYWVLTRKN-LBPRGKRZSA-N |
| XLogP | 1.83 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|