C12H21NO3 — CID 163782535
tert-butyl 2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]acetate (PubChem CID 163782535) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl 2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 163782535 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl 2-[(3R)-5,5-dimethyl-2-oxopyrrolidin-3-yl]acetate |
| SMILES | CC1(C)C[C@H](CC(=O)OC(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C12H21NO3/c1-11(2,3)16-9(14)6-8-7-12(4,5)13-10(8)15/h8H,6-7H2,1-5H3,(H,13,15)/t8-/m0/s1 |
| InChIKey | MPUHVOWWGQUMAN-QMMMGPOBSA-N |
| XLogP | 1.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |