C12H17F5O4S — CID 163782801
3,3,4,4,4-pentafluorobutyl 3-(1,1-dioxothian-4-yl)propanoate (PubChem CID 163782801) has the molecular formula C12H17F5O4S and a molecular weight of 352.32 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutyl 3-(1,1-dioxothian-4-yl)propanoate.
| Compound Name | 3,3,4,4,4-pentafluorobutyl 3-(1,1-dioxothian-4-yl)propanoate |
|---|---|
| PubChem CID | 163782801 |
| Molecular Formula | C12H17F5O4S |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutyl 3-(1,1-dioxothian-4-yl)propanoate |
| SMILES | O=C(CCC1CCS(=O)(=O)CC1)OCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F5O4S/c13-11(14,12(15,16)17)5-6-21-10(18)2-1-9-3-7-22(19,20)8-4-9/h9H,1-8H2 |
| InChIKey | VSXIJPFIPRPARB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|