C9H16N2O — CID 163784013
N-[(2S,4R)-2-methyl-6-methylidenepiperidin-4-yl]acetamide (PubChem CID 163784013) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-[(2S,4R)-2-methyl-6-methylidenepiperidin-4-yl]acetamide.
| Compound Name | N-[(2S,4R)-2-methyl-6-methylidenepiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 163784013 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-[(2S,4R)-2-methyl-6-methylidenepiperidin-4-yl]acetamide |
| SMILES | C=C1C[C@H](NC(C)=O)C[C@H](C)N1 |
| InChI | InChI=1S/C9H16N2O/c1-6-4-9(11-8(3)12)5-7(2)10-6/h7,9-10H,1,4-5H2,2-3H3,(H,11,12)/t7-,9-/m0/s1 |
| InChIKey | MQZIWCXGRZKKQF-CBAPKCEASA-N |
| XLogP | 0.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |