C15H8BrF6N3O — CID 163784425
2-[4-amino-2,6-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazol-5-amine (PubChem CID 163784425) has the molecular formula C15H8BrF6N3O and a molecular weight of 440.14 g/mol. Its IUPAC name is 2-[4-amino-2,6-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazol-5-amine.
| Compound Name | 2-[4-amino-2,6-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 163784425 |
| Molecular Formula | C15H8BrF6N3O |
| Molecular Weight | 440.14 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 2-[4-amino-2,6-bis(trifluoromethyl)phenyl]-6-bromo-1,3-benzoxazol-5-amine |
| SMILES | Nc1cc(C(F)(F)F)c(-c2nc3cc(N)c(Br)cc3o2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8BrF6N3O/c16-8-3-11-10(4-9(8)24)25-13(26-11)12-6(14(17,18)19)1-5(23)2-7(12)15(20,21)22/h1-4H,23-24H2 |
| InChIKey | VLMFLJLEBPMTBL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.14 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|