C26H31N7O2 — CID 163784466
[4-[[5-(3-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-piperazin-1-ylethylamino)methanol (PubChem CID 163784466) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is [4-[[5-(3-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-piperazin-1-ylethylamino)methanol.
| Compound Name | [4-[[5-(3-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-piperazin-1-ylethylamino)methanol |
|---|---|
| PubChem CID | 163784466 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | [4-[[5-(3-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]-(2-piperazin-1-ylethylamino)methanol |
| SMILES | COc1cccc(-c2cccc3nc(Nc4ccc(C(O)NCCN5CCNCC5)cc4)nn23)c1 |
| InChI | InChI=1S/C26H31N7O2/c1-35-22-5-2-4-20(18-22)23-6-3-7-24-30-26(31-33(23)24)29-21-10-8-19(9-11-21)25(34)28-14-17-32-15-12-27-13-16-32/h2-11,18,25,27-28,34H,12-17H2,1H3,(H,29,31) |
| InChIKey | MRINWDWYSNHOEM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|