C24H29FN6O2 — CID 163785028
1-[8-amino-6-[6-(3-aminopropyl)-4,5-dimethyl-3-pyridinyl]-7-fluoroisoquinolin-3-yl]-3-[(3R)-oxolan-3-yl]urea (PubChem CID 163785028) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 1-[8-amino-6-[6-(3-aminopropyl)-4,5-dimethyl-3-pyridinyl]-7-fluoroisoquinolin-3-yl]-3-[(3R)-oxolan-3-yl]urea.
| Compound Name | 1-[8-amino-6-[6-(3-aminopropyl)-4,5-dimethyl-3-pyridinyl]-7-fluoroisoquinolin-3-yl]-3-[(3R)-oxolan-3-yl]urea |
|---|---|
| PubChem CID | 163785028 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[8-amino-6-[6-(3-aminopropyl)-4,5-dimethyl-3-pyridinyl]-7-fluoroisoquinolin-3-yl]-3-[(3R)-oxolan-3-yl]urea |
| SMILES | Cc1c(-c2cc3cc(NC(=O)N[C@@H]4CCOC4)ncc3c(N)c2F)cnc(CCCN)c1C |
| InChI | InChI=1S/C24H29FN6O2/c1-13-14(2)20(4-3-6-26)28-10-18(13)17-8-15-9-21(29-11-19(15)23(27)22(17)25)31-24(32)30-16-5-7-33-12-16/h8-11,16H,3-7,12,26-27H2,1-2H3,(H2,29,30,31,32)/t16-/m1/s1 |
| InChIKey | MRULHNLRJNNPCP-MRXNPFEDSA-N |
| XLogP | 3.44 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|