About 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone
2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone (PubChem CID 163785713) has the molecular formula C9H17F2IO4P-
and a molecular weight of 385.11 g/mol. Its IUPAC name is 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone.
Molecular Properties
| Compound Name | 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone |
| PubChem CID | 163785713 |
| Molecular Formula | C9H17F2IO4P- |
| Molecular Weight | 385.11 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone |
| SMILES | CCCOP(=O)(OCCC)C(F)(F)C(=O)[I-]C |
| InChI | InChI=1S/C9H17F2IO4P/c1-4-6-15-17(14,16-7-5-2)9(10,11)8(13)12-3/h4-7H2,1-3H3/q-1 |
| InChIKey | HIFRWUXTQMYSLD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.11 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone?
The IUPAC name of 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone (CID 163785713) is 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone.
What is the SMILES notation for 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone?
The canonical SMILES for 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone is CCCOP(=O)(OCCC)C(F)(F)C(=O)[I-]C.
What is the InChIKey of 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone?
The InChIKey is HIFRWUXTQMYSLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2IO4P/c1-4-6-15-17(14,16-7-5-2)9(10,11)8(13)12-3/h4-7H2,1-3H3/q-1.
What are the key properties of 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone?
2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone has a molecular weight of 385.11 g/mol, XLogP of -0.13, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dipropoxyphosphoryl-2,2-difluoro-1-methyliodanuidylethanone is sourced from PubChem (CID 163785713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).