C35H44N4O4 — CID 163785997
4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-2-phenylethyl]-3-oxoquinoxaline-2-carboxamide (PubChem CID 163785997) has the molecular formula C35H44N4O4 and a molecular weight of 584.76 g/mol. Its IUPAC name is 4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-2-phenylethyl]-3-oxoquinoxaline-2-carboxamide.
| Compound Name | 4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-2-phenylethyl]-3-oxoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 163785997 |
| Molecular Formula | C35H44N4O4 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-2-phenylethyl]-3-oxoquinoxaline-2-carboxamide |
| SMILES | COC1OC1C(Cc1ccccc1)NC(=O)c1nc2ccccc2n(C2C[C@H]3CC[C@@H](C2)N3C2CCCCCCC2)c1=O |
| InChI | InChI=1S/C35H44N4O4/c1-42-35-32(43-35)29(20-23-12-6-5-7-13-23)37-33(40)31-34(41)39(30-17-11-10-16-28(30)36-31)27-21-25-18-19-26(22-27)38(25)24-14-8-3-2-4-9-15-24/h5-7,10-13,16-17,24-27,29,32,35H,2-4,8-9,14-15,18-22H2,1H3,(H,37,40)/t25-,26+,27?,29?,32?,35? |
| InChIKey | MSOOVWSWEFNVQB-LMDOUONOSA-N |
| XLogP | 5.39 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|