C15H24FNO2 — CID 163787093
tert-butyl (4Z)-4-(3-fluorobutylidene)-3-methylidenepiperidine-1-carboxylate (PubChem CID 163787093) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is tert-butyl (4Z)-4-(3-fluorobutylidene)-3-methylidenepiperidine-1-carboxylate.
| Compound Name | tert-butyl (4Z)-4-(3-fluorobutylidene)-3-methylidenepiperidine-1-carboxylate |
|---|---|
| PubChem CID | 163787093 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | tert-butyl (4Z)-4-(3-fluorobutylidene)-3-methylidenepiperidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)CC/C1=C/CC(C)F |
| InChI | InChI=1S/C15H24FNO2/c1-11-10-17(14(18)19-15(3,4)5)9-8-13(11)7-6-12(2)16/h7,12H,1,6,8-10H2,2-5H3/b13-7- |
| InChIKey | MTMAKXVAZMXPLI-QPEQYQDCSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |