C15H19NO5 — CID 163787542
ethyl 6-(3-amino-5-methoxyphenyl)-2,4-dioxohexanoate (PubChem CID 163787542) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 6-(3-amino-5-methoxyphenyl)-2,4-dioxohexanoate.
| Compound Name | ethyl 6-(3-amino-5-methoxyphenyl)-2,4-dioxohexanoate |
|---|---|
| PubChem CID | 163787542 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | ethyl 6-(3-amino-5-methoxyphenyl)-2,4-dioxohexanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)CCc1cc(N)cc(OC)c1 |
| InChI | InChI=1S/C15H19NO5/c1-3-21-15(19)14(18)9-12(17)5-4-10-6-11(16)8-13(7-10)20-2/h6-8H,3-5,9,16H2,1-2H3 |
| InChIKey | MTVRSKJGNMQZFK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|