About 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol
1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol (PubChem CID 163787688) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol |
| PubChem CID | 163787688 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol |
| SMILES | NC1=CCC(N2CCN(CCO)CC(O)C2)C=C1 |
| InChI | InChI=1S/C13H23N3O2/c14-11-1-3-12(4-2-11)16-6-5-15(7-8-17)9-13(18)10-16/h1-3,12-13,17-18H,4-10,14H2 |
| InChIKey | MTYXAEBOGPZRPD-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol?
The IUPAC name of 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol (CID 163787688) is 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol.
What is the SMILES notation for 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol?
The canonical SMILES for 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol is NC1=CCC(N2CCN(CCO)CC(O)C2)C=C1.
What is the InChIKey of 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol?
The InChIKey is MTYXAEBOGPZRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c14-11-1-3-12(4-2-11)16-6-5-15(7-8-17)9-13(18)10-16/h1-3,12-13,17-18H,4-10,14H2.
What are the key properties of 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol?
1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol has a molecular weight of 253.35 g/mol, XLogP of -0.87, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminocyclohexa-2,4-dien-1-yl)-4-(2-hydroxyethyl)-1,4-diazepan-6-ol is sourced from PubChem (CID 163787688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).