C23H28N4O2S — CID 163788167
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)sulfinylamino]urea (PubChem CID 163788167) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)sulfinylamino]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)sulfinylamino]urea |
|---|---|
| PubChem CID | 163788167 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1-[(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)sulfinylamino]urea |
| SMILES | CN1CCc2cc(S(=O)NN(C(N)=O)c3c4c(cc5c3CCC5)CCC4)ccc2C1 |
| InChI | InChI=1S/C23H28N4O2S/c1-26-11-10-15-13-19(9-8-18(15)14-26)30(29)25-27(23(24)28)22-20-6-2-4-16(20)12-17-5-3-7-21(17)22/h8-9,12-13,25H,2-7,10-11,14H2,1H3,(H2,24,28) |
| InChIKey | MUIXXDFCCQHELZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|