C35H36BNO2+ — CID 163788526
CID 163788526 (PubChem CID 163788526) has the molecular formula C35H36BNO2+ and a molecular weight of 513.49 g/mol.
| Compound Name | CID 163788526 |
|---|---|
| PubChem CID | 163788526 |
| Molecular Formula | C35H36BNO2+ |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | — |
| SMILES | CC(C)C([OH2+])C(C)(C)O[B]c1ccc(-c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C35H35BNO2/c1-25(2)34(38)35(3,4)39-36-29-21-17-26(18-22-29)27-19-23-31(24-20-27)37(30-13-6-5-7-14-30)33-16-10-12-28-11-8-9-15-32(28)33/h5-25,34,38H,1-4H3/p+1 |
| InChIKey | SARSRNURQGSVTR-UHFFFAOYSA-O |
| XLogP | 7.77 |
| TPSA | 35.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|