C25H27FN6O — CID 163789461
N-[6-[4-[1-(4-fluorophenyl)ethyl]piperazin-1-yl]pyrimidin-4-yl]-1a,2,7,7a-tetrahydrooxireno[2,3-b]quinolin-5-amine (PubChem CID 163789461) has the molecular formula C25H27FN6O and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[6-[4-[1-(4-fluorophenyl)ethyl]piperazin-1-yl]pyrimidin-4-yl]-1a,2,7,7a-tetrahydrooxireno[2,3-b]quinolin-5-amine.
| Compound Name | N-[6-[4-[1-(4-fluorophenyl)ethyl]piperazin-1-yl]pyrimidin-4-yl]-1a,2,7,7a-tetrahydrooxireno[2,3-b]quinolin-5-amine |
|---|---|
| PubChem CID | 163789461 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[6-[4-[1-(4-fluorophenyl)ethyl]piperazin-1-yl]pyrimidin-4-yl]-1a,2,7,7a-tetrahydrooxireno[2,3-b]quinolin-5-amine |
| SMILES | CC(c1ccc(F)cc1)N1CCN(c2cc(Nc3ccc4c(c3)CC3OC3N4)ncn2)CC1 |
| InChI | InChI=1S/C25H27FN6O/c1-16(17-2-4-19(26)5-3-17)31-8-10-32(11-9-31)24-14-23(27-15-28-24)29-20-6-7-21-18(12-20)13-22-25(30-21)33-22/h2-7,12,14-16,22,25,30H,8-11,13H2,1H3,(H,27,28,29) |
| InChIKey | MVKBQPPVJFKAIS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|