C20H17IN4O5S — CID 163790146
4-[3-(hydroxymethyl)-1,2,4-oxadiazol-5-yl]-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-phenylbutan-1-one (PubChem CID 163790146) has the molecular formula C20H17IN4O5S and a molecular weight of 552.35 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)-1,2,4-oxadiazol-5-yl]-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-phenylbutan-1-one.
| Compound Name | 4-[3-(hydroxymethyl)-1,2,4-oxadiazol-5-yl]-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 163790146 |
| Molecular Formula | C20H17IN4O5S |
| Molecular Weight | 552.35 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | 4-[3-(hydroxymethyl)-1,2,4-oxadiazol-5-yl]-1-(7-iodo-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-4-phenylbutan-1-one |
| SMILES | O=C(CCC(c1ccccc1)c1nc(CO)no1)C1=NS(=O)(=O)c2cc(I)ccc2N1 |
| InChI | InChI=1S/C20H17IN4O5S/c21-13-6-8-15-17(10-13)31(28,29)25-19(22-15)16(27)9-7-14(12-4-2-1-3-5-12)20-23-18(11-26)24-30-20/h1-6,8,10,14,26H,7,9,11H2,(H,22,25) |
| InChIKey | MNFMCOCGSRYJIQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|