About 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene
4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene (PubChem CID 163790819) has the molecular formula C7H8IN2O3-
and a molecular weight of 295.06 g/mol. Its IUPAC name is 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene.
Molecular Properties
| Compound Name | 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene |
| PubChem CID | 163790819 |
| Molecular Formula | C7H8IN2O3- |
| Molecular Weight | 295.06 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene |
| SMILES | CC1=CN([O-])I=C(C)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C7H8IN2O3/c1-5-3-7(10(12)13)6(2)8-9(11)4-5/h3-4H,1-2H3/q-1 |
| InChIKey | MWOJNZMLZWOPOS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.06 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene?
The IUPAC name of 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene (CID 163790819) is 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene.
What is the SMILES notation for 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene?
The canonical SMILES for 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene is CC1=CN([O-])I=C(C)C([N+](=O)[O-])=C1.
What is the InChIKey of 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene?
The InChIKey is MWOJNZMLZWOPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8IN2O3/c1-5-3-7(10(12)13)6(2)8-9(11)4-5/h3-4H,1-2H3/q-1.
What are the key properties of 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene?
4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene has a molecular weight of 295.06 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-6-nitro-2-oxido-1λ3-ioda-2-azacyclohepta-3,5,7-triene is sourced from PubChem (CID 163790819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).