C22H31N3O — CID 163791059
(2,6,8a-trimethyl-3-phenyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-8-yl)-piperidin-1-ylmethanone (PubChem CID 163791059) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is (2,6,8a-trimethyl-3-phenyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-8-yl)-piperidin-1-ylmethanone.
| Compound Name | (2,6,8a-trimethyl-3-phenyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-8-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 163791059 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | (2,6,8a-trimethyl-3-phenyl-5,6,7,8-tetrahydro-1H-imidazo[1,2-a]pyridin-8-yl)-piperidin-1-ylmethanone |
| SMILES | CC1=C(c2ccccc2)N2CC(C)CC(C(=O)N3CCCCC3)C2(C)N1 |
| InChI | InChI=1S/C22H31N3O/c1-16-14-19(21(26)24-12-8-5-9-13-24)22(3)23-17(2)20(25(22)15-16)18-10-6-4-7-11-18/h4,6-7,10-11,16,19,23H,5,8-9,12-15H2,1-3H3 |
| InChIKey | MWTMOKNQCWXTNG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |