C25H42O4 — CID 163791400
(4R)-4-[(1S,2S,5R,6R,9S,10R,11S,13R,15R)-11,15-dihydroxy-1,5-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]pentanoic acid (PubChem CID 163791400) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (4R)-4-[(1S,2S,5R,6R,9S,10R,11S,13R,15R)-11,15-dihydroxy-1,5-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]pentanoic acid.
| Compound Name | (4R)-4-[(1S,2S,5R,6R,9S,10R,11S,13R,15R)-11,15-dihydroxy-1,5-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]pentanoic acid |
|---|---|
| PubChem CID | 163791400 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (4R)-4-[(1S,2S,5R,6R,9S,10R,11S,13R,15R)-11,15-dihydroxy-1,5-dimethyl-6-tetracyclo[11.4.1.02,10.05,9]octadecanyl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C[C@H]4C[C@H](O)CC[C@@](C)(C4)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H42O4/c1-15(4-7-22(28)29)18-5-6-20-23-19(9-11-25(18,20)3)24(2)10-8-17(26)12-16(14-24)13-21(23)27/h15-21,23,26-27H,4-14H2,1-3H3,(H,28,29)/t15-,16-,17-,18-,19+,20+,21+,23-,24+,25-/m1/s1 |
| InChIKey | MXCFYPRFWHZINZ-LFJORCGLSA-N |
| XLogP | 4.87 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |