C7H8N2 — CID 163792828
4-methyl-2,3-dihydropyridine-3-carbonitrile (PubChem CID 163792828) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 4-methyl-2,3-dihydropyridine-3-carbonitrile.
| Compound Name | 4-methyl-2,3-dihydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163792828 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 4-methyl-2,3-dihydropyridine-3-carbonitrile |
| SMILES | CC1=CC=NCC1C#N |
| InChI | InChI=1S/C7H8N2/c1-6-2-3-9-5-7(6)4-8/h2-3,7H,5H2,1H3 |
| InChIKey | MYHAQPNBRMWGHO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |