C20H20N4O4S — CID 163793114
4-[(7,11-dimethyl-6-oxo-11,11a-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid (PubChem CID 163793114) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 4-[(7,11-dimethyl-6-oxo-11,11a-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 4-[(7,11-dimethyl-6-oxo-11,11a-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 163793114 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[(7,11-dimethyl-6-oxo-11,11a-dihydro-5H-pyrimido[5,4-d][1]benzazepin-2-yl)amino]benzenesulfonic acid |
| SMILES | CC1C=CC=C2C1c1nc(Nc3ccc(S(=O)(=O)O)cc3)ncc1CC(=O)N2C |
| InChI | InChI=1S/C20H20N4O4S/c1-12-4-3-5-16-18(12)19-13(10-17(25)24(16)2)11-21-20(23-19)22-14-6-8-15(9-7-14)29(26,27)28/h3-9,11-12,18H,10H2,1-2H3,(H,21,22,23)(H,26,27,28) |
| InChIKey | MYNXMCKIEYJDHL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|