About [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid
[[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid (PubChem CID 163793506) has the molecular formula C5H13N2O4P
and a molecular weight of 196.14 g/mol. Its IUPAC name is [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid.
Molecular Properties
| Compound Name | [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid |
| PubChem CID | 163793506 |
| Molecular Formula | C5H13N2O4P |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid |
| SMILES | CNP(=O)(O)NC[C@@]1(O)CC1O |
| InChI | InChI=1S/C5H13N2O4P/c1-6-12(10,11)7-3-5(9)2-4(5)8/h4,8-9H,2-3H2,1H3,(H3,6,7,10,11)/t4?,5-/m0/s1 |
| InChIKey | MYVIEOOXAASCBK-AKGZTFGVSA-N |
| XLogP | -1.61 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid?
The IUPAC name of [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid (CID 163793506) is [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid.
What is the SMILES notation for [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid?
The canonical SMILES for [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid is CNP(=O)(O)NC[C@@]1(O)CC1O.
What is the InChIKey of [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid?
The InChIKey is MYVIEOOXAASCBK-AKGZTFGVSA-N. The full InChI is InChI=1S/C5H13N2O4P/c1-6-12(10,11)7-3-5(9)2-4(5)8/h4,8-9H,2-3H2,1H3,(H3,6,7,10,11)/t4?,5-/m0/s1.
What are the key properties of [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid?
[[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid has a molecular weight of 196.14 g/mol, XLogP of -1.61, 4 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1S)-1,2-dihydroxycyclopropyl]methylamino]-(methylamino)phosphinic acid is sourced from PubChem (CID 163793506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).