About 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate
2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate (PubChem CID 163793566) has the molecular formula C11H18NO4-
and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate.
Molecular Properties
| Compound Name | 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate |
| PubChem CID | 163793566 |
| Molecular Formula | C11H18NO4- |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate |
| SMILES | CC(=O)[C@@H]1C(OC(C)(C)[O-])CCN1C(C)=O |
| InChI | InChI=1S/C11H18NO4/c1-7(13)10-9(16-11(3,4)15)5-6-12(10)8(2)14/h9-10H,5-6H2,1-4H3/q-1/t9?,10-/m1/s1 |
| InChIKey | MYWPCTVEWXBJOL-QVDQXJPCSA-N |
| XLogP | -0.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate?
The IUPAC name of 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate (CID 163793566) is 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate.
What is the SMILES notation for 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate?
The canonical SMILES for 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate is CC(=O)[C@@H]1C(OC(C)(C)[O-])CCN1C(C)=O.
What is the InChIKey of 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate?
The InChIKey is MYWPCTVEWXBJOL-QVDQXJPCSA-N. The full InChI is InChI=1S/C11H18NO4/c1-7(13)10-9(16-11(3,4)15)5-6-12(10)8(2)14/h9-10H,5-6H2,1-4H3/q-1/t9?,10-/m1/s1.
What are the key properties of 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate?
2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate has a molecular weight of 228.27 g/mol, XLogP of -0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1,2-diacetylpyrrolidin-3-yl]oxypropan-2-olate is sourced from PubChem (CID 163793566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).