C35H42AlF2N5O6S — CID 163793750
CID 163793750 (PubChem CID 163793750) has the molecular formula C35H42AlF2N5O6S and a molecular weight of 725.80 g/mol.
| Compound Name | CID 163793750 |
|---|---|
| PubChem CID | 163793750 |
| Molecular Formula | C35H42AlF2N5O6S |
| Molecular Weight | 725.80 g/mol |
| Exact Mass | 725.26 |
| IUPAC Name | — |
| SMILES | COC(=O)CC(S[Al])C(=O)N/C=C/NC(=O)[C@@H](N)CCN(C(=O)CO)[C@@H](c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H43F2N5O6S.Al/c1-35(2,3)32(28-16-23(25-17-24(36)10-11-26(25)37)20-41(28)19-22-8-6-5-7-9-22)42(30(44)21-43)15-12-27(38)33(46)39-13-14-40-34(47)29(49)18-31(45)48-4;/h5-11,13-14,16-17,20,27,29,32,43,49H,12,15,18-19,21,38H2,1-4H3,(H,39,46)(H,40,47);/q;+1/p-1/b14-13+;/t27-,29?,32-;/m0./s1 |
| InChIKey | VYRKFLFKBJIJTD-QFELBRSSSA-M |
| XLogP | 3.56 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |