C20H22N4O2 — CID 163793964
5-amino-4-[(1E)-2-(3,5-dimethyl-1,2-oxazol-4-yl)buta-1,3-dienyl]-3-(1-phenylethyl)-1H-imidazol-2-one (PubChem CID 163793964) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5-amino-4-[(1E)-2-(3,5-dimethyl-1,2-oxazol-4-yl)buta-1,3-dienyl]-3-(1-phenylethyl)-1H-imidazol-2-one.
| Compound Name | 5-amino-4-[(1E)-2-(3,5-dimethyl-1,2-oxazol-4-yl)buta-1,3-dienyl]-3-(1-phenylethyl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 163793964 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5-amino-4-[(1E)-2-(3,5-dimethyl-1,2-oxazol-4-yl)buta-1,3-dienyl]-3-(1-phenylethyl)-1H-imidazol-2-one |
| SMILES | C=C/C(=C\c1c(N)[nH]c(=O)n1C(C)c1ccccc1)c1c(C)noc1C |
| InChI | InChI=1S/C20H22N4O2/c1-5-15(18-12(2)23-26-14(18)4)11-17-19(21)22-20(25)24(17)13(3)16-9-7-6-8-10-16/h5-11,13H,1,21H2,2-4H3,(H,22,25)/b15-11+ |
| InChIKey | MZDZRSHHBMCOFO-RVDMUPIBSA-N |
| XLogP | 3.70 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|