About N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride
N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride (PubChem CID 163794306) has the molecular formula C7H12FN5
and a molecular weight of 185.21 g/mol. Its IUPAC name is N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride.
Molecular Properties
| Compound Name | N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride |
| PubChem CID | 163794306 |
| Molecular Formula | C7H12FN5 |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride |
| SMILES | [H]/N=C(N)/C(N)=C(\N=C(C)F)NC=C |
| InChI | InChI=1S/C7H12FN5/c1-3-12-7(13-4(2)8)5(9)6(10)11/h3,12H,1,9H2,2H3,(H3,10,11)/b7-5+,13-4? |
| InChIKey | MZLUNYAAKYNKQT-SKLGPPTQSA-N |
| XLogP | 0.17 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride?
The IUPAC name of N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride (CID 163794306) is N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride.
What is the SMILES notation for N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride?
The canonical SMILES for N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride is [H]/N=C(N)/C(N)=C(\N=C(C)F)NC=C.
What is the InChIKey of N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride?
The InChIKey is MZLUNYAAKYNKQT-SKLGPPTQSA-N. The full InChI is InChI=1S/C7H12FN5/c1-3-12-7(13-4(2)8)5(9)6(10)11/h3,12H,1,9H2,2H3,(H3,10,11)/b7-5+,13-4?.
What are the key properties of N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride?
N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride has a molecular weight of 185.21 g/mol, XLogP of 0.17, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2,3-diamino-1-(ethenylamino)-3-iminoprop-1-enyl]ethanimidoyl fluoride is sourced from PubChem (CID 163794306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).