C31H21N3 — CID 163794965
2-naphthalen-2-yl-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 163794965) has the molecular formula C31H21N3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-naphthalen-2-yl-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-naphthalen-2-yl-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163794965 |
| Molecular Formula | C31H21N3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-naphthalen-2-yl-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc5ccccc5c4)n3)c2)cc1 |
| InChI | InChI=1S/C31H21N3/c1-3-10-22(11-4-1)26-16-9-17-27(20-26)30-32-29(24-13-5-2-6-14-24)33-31(34-30)28-19-18-23-12-7-8-15-25(23)21-28/h1-21H |
| InChIKey | CDYXWAANZAGCCJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |