About 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine
1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine (PubChem CID 163795529) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine |
| PubChem CID | 163795529 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine |
| SMILES | C/N=C/COCc1ccc(CC(NC)NC)cc1 |
| InChI | InChI=1S/C14H23N3O/c1-15-8-9-18-11-13-6-4-12(5-7-13)10-14(16-2)17-3/h4-8,14,16-17H,9-11H2,1-3H3/b15-8+ |
| InChIKey | NAKVSZGEEUISAD-OVCLIPMQSA-N |
| XLogP | 1.21 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine?
The IUPAC name of 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine (CID 163795529) is 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine.
What is the SMILES notation for 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine?
The canonical SMILES for 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine is C/N=C/COCc1ccc(CC(NC)NC)cc1.
What is the InChIKey of 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine?
The InChIKey is NAKVSZGEEUISAD-OVCLIPMQSA-N. The full InChI is InChI=1S/C14H23N3O/c1-15-8-9-18-11-13-6-4-12(5-7-13)10-14(16-2)17-3/h4-8,14,16-17H,9-11H2,1-3H3/b15-8+.
What are the key properties of 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine?
1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine has a molecular weight of 249.36 g/mol, XLogP of 1.21, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N'-dimethyl-2-[4-(2-methyliminoethoxymethyl)phenyl]ethane-1,1-diamine is sourced from PubChem (CID 163795529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).