C21H24N2O3 — CID 163795764
3-[5-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-2-pyridinyl]-4-ethyl-5-(methoxymethyl)-1,3-oxazolidin-2-one (PubChem CID 163795764) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-[5-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-2-pyridinyl]-4-ethyl-5-(methoxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[5-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-2-pyridinyl]-4-ethyl-5-(methoxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 163795764 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-[5-[(3E,5Z)-3-ethenylhepta-3,5-dien-1-ynyl]-2-pyridinyl]-4-ethyl-5-(methoxymethyl)-1,3-oxazolidin-2-one |
| SMILES | C=C/C(C#Cc1ccc(N2C(=O)OC(COC)C2CC)nc1)=C\C=C/C |
| InChI | InChI=1S/C21H24N2O3/c1-5-8-9-16(6-2)10-11-17-12-13-20(22-14-17)23-18(7-3)19(15-25-4)26-21(23)24/h5-6,8-9,12-14,18-19H,2,7,15H2,1,3-4H3/b8-5-,16-9+ |
| InChIKey | NAPZSXSRHNQUMB-UDTWMHFTSA-N |
| XLogP | 3.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|