About 2-aminobenzenethiolate;gold(1+);triethylphosphane
2-aminobenzenethiolate;gold(1+);triethylphosphane (PubChem CID 163795824) has the molecular formula C12H21AuNPS
and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-aminobenzenethiolate;gold(1+);triethylphosphane.
Molecular Properties
| Compound Name | 2-aminobenzenethiolate;gold(1+);triethylphosphane |
| PubChem CID | 163795824 |
| Molecular Formula | C12H21AuNPS |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-aminobenzenethiolate;gold(1+);triethylphosphane |
| SMILES | CCP(CC)CC.Nc1ccccc1[S-].[Au+] |
| InChI | InChI=1S/C6H7NS.C6H15P.Au/c7-5-3-1-2-4-6(5)8;1-4-7(5-2)6-3;/h1-4,8H,7H2;4-6H2,1-3H3;/q;;+1/p-1 |
| InChIKey | NARIPAMZTRTXAT-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzenethiolate;gold(1+);triethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzenethiolate;gold(1+);triethylphosphane?
The IUPAC name of 2-aminobenzenethiolate;gold(1+);triethylphosphane (CID 163795824) is 2-aminobenzenethiolate;gold(1+);triethylphosphane.
What is the SMILES notation for 2-aminobenzenethiolate;gold(1+);triethylphosphane?
The canonical SMILES for 2-aminobenzenethiolate;gold(1+);triethylphosphane is CCP(CC)CC.Nc1ccccc1[S-].[Au+].
What is the InChIKey of 2-aminobenzenethiolate;gold(1+);triethylphosphane?
The InChIKey is NARIPAMZTRTXAT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NS.C6H15P.Au/c7-5-3-1-2-4-6(5)8;1-4-7(5-2)6-3;/h1-4,8H,7H2;4-6H2,1-3H3;/q;;+1/p-1.
What are the key properties of 2-aminobenzenethiolate;gold(1+);triethylphosphane?
2-aminobenzenethiolate;gold(1+);triethylphosphane has a molecular weight of 439.32 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzenethiolate;gold(1+);triethylphosphane is sourced from PubChem (CID 163795824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).