About ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate
ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate (PubChem CID 163796822) has the molecular formula C14H14F3NO2
and a molecular weight of 285.27 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate |
| PubChem CID | 163796822 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C)=C(\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO2/c1-3-20-13(19)11(9-18-2)12(14(15,16)17)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3/b12-11+,18-9+ |
| InChIKey | NBNGNHCWOOEBOL-YEUDOZOASA-N |
| XLogP | 3.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate?
The IUPAC name of ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate (CID 163796822) is ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate.
What is the SMILES notation for ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate?
The canonical SMILES for ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate is CCOC(=O)C(/C=N/C)=C(\c1ccccc1)C(F)(F)F.
What is the InChIKey of ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate?
The InChIKey is NBNGNHCWOOEBOL-YEUDOZOASA-N. The full InChI is InChI=1S/C14H14F3NO2/c1-3-20-13(19)11(9-18-2)12(14(15,16)17)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3/b12-11+,18-9+.
What are the key properties of ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate?
ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate has a molecular weight of 285.27 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4,4,4-trifluoro-2-(methyliminomethyl)-3-phenylbut-2-enoate is sourced from PubChem (CID 163796822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).