C14H23N — CID 163798220
1-[(1E)-4-ethenyl-4-methylhexa-1,5-dienyl]piperidine (PubChem CID 163798220) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-[(1E)-4-ethenyl-4-methylhexa-1,5-dienyl]piperidine.
| Compound Name | 1-[(1E)-4-ethenyl-4-methylhexa-1,5-dienyl]piperidine |
|---|---|
| PubChem CID | 163798220 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-[(1E)-4-ethenyl-4-methylhexa-1,5-dienyl]piperidine |
| SMILES | C=CC(C)(C=C)C/C=C/N1CCCCC1 |
| InChI | InChI=1S/C14H23N/c1-4-14(3,5-2)10-9-13-15-11-7-6-8-12-15/h4-5,9,13H,1-2,6-8,10-12H2,3H3/b13-9+ |
| InChIKey | NCRGCYYBLARVMB-UKTHLTGXSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|