About (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol
(2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol (PubChem CID 163798954) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol |
| PubChem CID | 163798954 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol |
| SMILES | C/C=C\C=C/C(S)NC |
| InChI | InChI=1S/C7H13NS/c1-3-4-5-6-7(9)8-2/h3-9H,1-2H3/b4-3-,6-5- |
| InChIKey | NDHIIIXJNBVCIW-OUPQRBNQSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol?
The IUPAC name of (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol (CID 163798954) is (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol.
What is the SMILES notation for (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol?
The canonical SMILES for (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol is C/C=C\C=C/C(S)NC.
What is the InChIKey of (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol?
The InChIKey is NDHIIIXJNBVCIW-OUPQRBNQSA-N. The full InChI is InChI=1S/C7H13NS/c1-3-4-5-6-7(9)8-2/h3-9H,1-2H3/b4-3-,6-5-.
What are the key properties of (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol?
(2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol has a molecular weight of 143.25 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-1-(methylamino)hexa-2,4-diene-1-thiol is sourced from PubChem (CID 163798954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).