C18H29N3O3 — CID 163799275
4-(dimethylamino)-3-[(4-pentylphenyl)carbamoylamino]butanoic acid (PubChem CID 163799275) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(dimethylamino)-3-[(4-pentylphenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-(dimethylamino)-3-[(4-pentylphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 163799275 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 4-(dimethylamino)-3-[(4-pentylphenyl)carbamoylamino]butanoic acid |
| SMILES | CCCCCc1ccc(NC(=O)NC(CC(=O)O)CN(C)C)cc1 |
| InChI | InChI=1S/C18H29N3O3/c1-4-5-6-7-14-8-10-15(11-9-14)19-18(24)20-16(12-17(22)23)13-21(2)3/h8-11,16H,4-7,12-13H2,1-3H3,(H,22,23)(H2,19,20,24) |
| InChIKey | NDOZEVTUSLTXSC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|