About 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione
7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione (PubChem CID 163799436) has the molecular formula C18H8O7
and a molecular weight of 336.26 g/mol. Its IUPAC name is 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione.
Molecular Properties
| Compound Name | 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione |
| PubChem CID | 163799436 |
| Molecular Formula | C18H8O7 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione |
| SMILES | O=C1Cc2ccc(C(=O)c3ccc4c(c3)C(=O)OC4=O)cc2C(=O)O1 |
| InChI | InChI=1S/C18H8O7/c19-14-7-8-1-2-9(5-12(8)17(22)24-14)15(20)10-3-4-11-13(6-10)18(23)25-16(11)21/h1-6H,7H2 |
| InChIKey | NDSBKQWXUDVQTB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione?
The IUPAC name of 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione (CID 163799436) is 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione.
What is the SMILES notation for 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione?
The canonical SMILES for 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione is O=C1Cc2ccc(C(=O)c3ccc4c(c3)C(=O)OC4=O)cc2C(=O)O1.
What is the InChIKey of 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione?
The InChIKey is NDSBKQWXUDVQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8O7/c19-14-7-8-1-2-9(5-12(8)17(22)24-14)15(20)10-3-4-11-13(6-10)18(23)25-16(11)21/h1-6H,7H2.
What are the key properties of 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione?
7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione has a molecular weight of 336.26 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,3-dioxo-2-benzofuran-5-carbonyl)-4H-isochromene-1,3-dione is sourced from PubChem (CID 163799436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).