C39H20F6N4O2 — CID 163799859
2-[2,5-bis[3-(trifluoromethyl)carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione (PubChem CID 163799859) has the molecular formula C39H20F6N4O2 and a molecular weight of 690.60 g/mol. Its IUPAC name is 2-[2,5-bis[3-(trifluoromethyl)carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione.
| Compound Name | 2-[2,5-bis[3-(trifluoromethyl)carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163799859 |
| Molecular Formula | C39H20F6N4O2 |
| Molecular Weight | 690.60 g/mol |
| Exact Mass | 690.15 |
| IUPAC Name | 2-[2,5-bis[3-(trifluoromethyl)carbazol-9-yl]-4-pyridinyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(-n2c3ccccc3c3cc(C(F)(F)F)ccc32)ncc1-n1c2ccccc2c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C39H20F6N4O2/c40-38(41,42)21-13-15-31-27(17-21)23-7-3-5-11-29(23)47(31)34-20-46-35(19-33(34)49-36(50)25-9-1-2-10-26(25)37(49)51)48-30-12-6-4-8-24(30)28-18-22(39(43,44)45)14-16-32(28)48/h1-20H |
| InChIKey | NEASQKTZQUEHRF-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.60 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|