About 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane
1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane (PubChem CID 163799967) has the molecular formula C12H23I2NO
and a molecular weight of 451.13 g/mol. Its IUPAC name is 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane.
Molecular Properties
| Compound Name | 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane |
| PubChem CID | 163799967 |
| Molecular Formula | C12H23I2NO |
| Molecular Weight | 451.13 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane |
| SMILES | CCC(C)(C)CI1CCCC(N=C=O)I1C |
| InChI | InChI=1S/C12H23I2NO/c1-5-12(2,3)9-14-8-6-7-11(13(14)4)15-10-16/h11H,5-9H2,1-4H3 |
| InChIKey | NECMGXGICALCIQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.13 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane?
The IUPAC name of 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane (CID 163799967) is 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane.
What is the SMILES notation for 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane?
The canonical SMILES for 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane is CCC(C)(C)CI1CCCC(N=C=O)I1C.
What is the InChIKey of 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane?
The InChIKey is NECMGXGICALCIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23I2NO/c1-5-12(2,3)9-14-8-6-7-11(13(14)4)15-10-16/h11H,5-9H2,1-4H3.
What are the key properties of 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane?
1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane has a molecular weight of 451.13 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylbutyl)-3-isocyanato-2-methyl-1λ3,2λ3-diiodinane is sourced from PubChem (CID 163799967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).