C23H25N3O5 — CID 163800599
N-hydroxy-4-(morpholine-4-carbonyl)-2'-phenylspiro[2,5-dihydro-1,4-benzoxazepine-3,1'-cyclopropane]-8-carboxamide (PubChem CID 163800599) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-hydroxy-4-(morpholine-4-carbonyl)-2'-phenylspiro[2,5-dihydro-1,4-benzoxazepine-3,1'-cyclopropane]-8-carboxamide.
| Compound Name | N-hydroxy-4-(morpholine-4-carbonyl)-2'-phenylspiro[2,5-dihydro-1,4-benzoxazepine-3,1'-cyclopropane]-8-carboxamide |
|---|---|
| PubChem CID | 163800599 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-hydroxy-4-(morpholine-4-carbonyl)-2'-phenylspiro[2,5-dihydro-1,4-benzoxazepine-3,1'-cyclopropane]-8-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)OCC1(CC1c1ccccc1)N(C(=O)N1CCOCC1)C2 |
| InChI | InChI=1S/C23H25N3O5/c27-21(24-29)17-6-7-18-14-26(22(28)25-8-10-30-11-9-25)23(15-31-20(18)12-17)13-19(23)16-4-2-1-3-5-16/h1-7,12,19,29H,8-11,13-15H2,(H,24,27) |
| InChIKey | NEPNCGMHMWWSGU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|