C7H13NO2 — CID 163800814
(3S,4S,5S)-3-amino-3,4,5-trimethyloxolan-2-one (PubChem CID 163800814) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (3S,4S,5S)-3-amino-3,4,5-trimethyloxolan-2-one.
| Compound Name | (3S,4S,5S)-3-amino-3,4,5-trimethyloxolan-2-one |
|---|---|
| PubChem CID | 163800814 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (3S,4S,5S)-3-amino-3,4,5-trimethyloxolan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@@](C)(N)[C@@H]1C |
| InChI | InChI=1S/C7H13NO2/c1-4-5(2)10-6(9)7(4,3)8/h4-5H,8H2,1-3H3/t4-,5+,7+/m1/s1 |
| InChIKey | NEUFVSLMMLBWBK-ZDLURKLDSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |