C23H34N4O6 — CID 163801351
2-[[2-[[2-[[1-hydroxy-2-(2-methylprop-2-enoylamino)ethyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 163801351) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[[2-[[2-[[1-hydroxy-2-(2-methylprop-2-enoylamino)ethyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[1-hydroxy-2-(2-methylprop-2-enoylamino)ethyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 163801351 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-[[2-[[2-[[1-hydroxy-2-(2-methylprop-2-enoylamino)ethyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | C=C(C)C(=O)NCC(O)NC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H34N4O6/c1-14(2)10-17(22(32)25-13-20(29)30)27-23(33)18(11-16-8-6-5-7-9-16)26-19(28)12-24-21(31)15(3)4/h5-9,14,17-19,26,28H,3,10-13H2,1-2,4H3,(H,24,31)(H,25,32)(H,27,33)(H,29,30) |
| InChIKey | NFGFZLJJRHUKRF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|