C20H22N4O4S2 — CID 163801432
S-[(3S,6S,7aR)-7a-acetylsulfanyl-6-cyano-2,3,6-trimethyl-1,4-dioxo-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-3-yl] ethanethioate (PubChem CID 163801432) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is S-[(3S,6S,7aR)-7a-acetylsulfanyl-6-cyano-2,3,6-trimethyl-1,4-dioxo-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-3-yl] ethanethioate.
| Compound Name | S-[(3S,6S,7aR)-7a-acetylsulfanyl-6-cyano-2,3,6-trimethyl-1,4-dioxo-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 163801432 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | S-[(3S,6S,7aR)-7a-acetylsulfanyl-6-cyano-2,3,6-trimethyl-1,4-dioxo-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@]12C[C@](C)(C#N)C(c3cncnc3)C1C(=O)[C@](C)(SC(C)=O)N(C)C2=O |
| InChI | InChI=1S/C20H22N4O4S2/c1-11(25)29-19(4)16(27)15-14(13-6-22-10-23-7-13)18(3,9-21)8-20(15,30-12(2)26)17(28)24(19)5/h6-7,10,14-15H,8H2,1-5H3/t14?,15?,18-,19+,20-/m1/s1 |
| InChIKey | NFHUWPBDYFDWOD-BURCVLKOSA-N |
| XLogP | 2.17 |
| TPSA | 121.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|