C21H24N8OS — CID 163802067
2-[(1S,6S,8S)-8-[[4-[[5-(hydroxymethyl)-1H-pyrazol-3-yl]amino]thieno[2,3-d]pyrimidin-2-yl]amino]-10-azatricyclo[4.3.1.03,10]decan-3-yl]acetonitrile (PubChem CID 163802067) has the molecular formula C21H24N8OS and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-[(1S,6S,8S)-8-[[4-[[5-(hydroxymethyl)-1H-pyrazol-3-yl]amino]thieno[2,3-d]pyrimidin-2-yl]amino]-10-azatricyclo[4.3.1.03,10]decan-3-yl]acetonitrile.
| Compound Name | 2-[(1S,6S,8S)-8-[[4-[[5-(hydroxymethyl)-1H-pyrazol-3-yl]amino]thieno[2,3-d]pyrimidin-2-yl]amino]-10-azatricyclo[4.3.1.03,10]decan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 163802067 |
| Molecular Formula | C21H24N8OS |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[(1S,6S,8S)-8-[[4-[[5-(hydroxymethyl)-1H-pyrazol-3-yl]amino]thieno[2,3-d]pyrimidin-2-yl]amino]-10-azatricyclo[4.3.1.03,10]decan-3-yl]acetonitrile |
| SMILES | N#CCC12CC[C@H]3C[C@H](Nc4nc(Nc5cc(CO)[nH]n5)c5ccsc5n4)C[C@@H](C1)N32 |
| InChI | InChI=1S/C21H24N8OS/c22-5-4-21-3-1-14-7-12(8-15(10-21)29(14)21)23-20-25-18(16-2-6-31-19(16)26-20)24-17-9-13(11-30)27-28-17/h2,6,9,12,14-15,30H,1,3-4,7-8,10-11H2,(H3,23,24,25,26,27,28)/t12-,14-,15-,21?/m0/s1 |
| InChIKey | NFVZQUCWCAHKHN-GWQJKTGSSA-N |
| XLogP | 3.11 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |