C15H20N2O — CID 163802154
(9R,10S,15S,16S)-16-methyl-6,14-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3-dien-5-one (PubChem CID 163802154) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (9R,10S,15S,16S)-16-methyl-6,14-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3-dien-5-one.
| Compound Name | (9R,10S,15S,16S)-16-methyl-6,14-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3-dien-5-one |
|---|---|
| PubChem CID | 163802154 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (9R,10S,15S,16S)-16-methyl-6,14-diazatetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3-dien-5-one |
| SMILES | C[C@@H]1C2c3ccc(=O)[nH]c3C[C@H]1[C@@H]1CCCN[C@H]21 |
| InChI | InChI=1S/C15H20N2O/c1-8-11-7-12-10(4-5-13(18)17-12)14(8)15-9(11)3-2-6-16-15/h4-5,8-9,11,14-16H,2-3,6-7H2,1H3,(H,17,18)/t8-,9-,11+,14?,15-/m0/s1 |
| InChIKey | NFXUOYDGLKDJNV-PYTYNQPCSA-N |
| XLogP | 1.65 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |