About 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid
6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 163802628) has the molecular formula C8H13N2O3S+
and a molecular weight of 217.27 g/mol. Its IUPAC name is 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid |
| PubChem CID | 163802628 |
| Molecular Formula | C8H13N2O3S+ |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)SC2C(N)C(=O)[NH+]2C1C(=O)O |
| InChI | InChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/p+1 |
| InChIKey | NGHVIOIJCVXTGV-UHFFFAOYSA-O |
| XLogP | -1.96 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid?
The IUPAC name of 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid (CID 163802628) is 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid.
What is the SMILES notation for 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid?
The canonical SMILES for 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid is CC1(C)SC2C(N)C(=O)[NH+]2C1C(=O)O.
What is the InChIKey of 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid?
The InChIKey is NGHVIOIJCVXTGV-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H12N2O3S/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8/h3-4,6H,9H2,1-2H3,(H,12,13)/p+1.
What are the key properties of 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid?
6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid has a molecular weight of 217.27 g/mol, XLogP of -1.96, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid is sourced from PubChem (CID 163802628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).