C23H25N5O3S — CID 163802662
3-[7-(4-methylsulfonylphenyl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]aniline (PubChem CID 163802662) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is 3-[7-(4-methylsulfonylphenyl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]aniline.
| Compound Name | 3-[7-(4-methylsulfonylphenyl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]aniline |
|---|---|
| PubChem CID | 163802662 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[7-(4-methylsulfonylphenyl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]aniline |
| SMILES | CS(=O)(=O)c1ccc(N2CCc3c(-c4cccc(N)c4)nc(N4CCOCC4)nc32)cc1 |
| InChI | InChI=1S/C23H25N5O3S/c1-32(29,30)19-7-5-18(6-8-19)28-10-9-20-21(16-3-2-4-17(24)15-16)25-23(26-22(20)28)27-11-13-31-14-12-27/h2-8,15H,9-14,24H2,1H3 |
| InChIKey | NGINNRUGFCYCOG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|