C22H25F4N5O4 — CID 163802837
4-[8-[(2-hydroxy-2-methylpropyl)amino]-6-(2,2,3,3-tetrafluoro-4-hydroxybutoxy)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide (PubChem CID 163802837) has the molecular formula C22H25F4N5O4 and a molecular weight of 499.47 g/mol. Its IUPAC name is 4-[8-[(2-hydroxy-2-methylpropyl)amino]-6-(2,2,3,3-tetrafluoro-4-hydroxybutoxy)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide.
| Compound Name | 4-[8-[(2-hydroxy-2-methylpropyl)amino]-6-(2,2,3,3-tetrafluoro-4-hydroxybutoxy)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 163802837 |
| Molecular Formula | C22H25F4N5O4 |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 4-[8-[(2-hydroxy-2-methylpropyl)amino]-6-(2,2,3,3-tetrafluoro-4-hydroxybutoxy)imidazo[1,2-b]pyridazin-3-yl]-2-methylbenzamide |
| SMILES | Cc1cc(-c2cnc3c(NCC(C)(C)O)cc(OCC(F)(F)C(F)(F)CO)nn23)ccc1C(N)=O |
| InChI | InChI=1S/C22H25F4N5O4/c1-12-6-13(4-5-14(12)18(27)33)16-8-28-19-15(29-9-20(2,3)34)7-17(30-31(16)19)35-11-22(25,26)21(23,24)10-32/h4-8,29,32,34H,9-11H2,1-3H3,(H2,27,33) |
| InChIKey | NGMRUAWEMGJGKE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|