C25H24N6OS — CID 163803352
2-methyl-5-[2-[5-[(4-pyrazol-1-ylcyclohexa-1,3-dien-1-yl)methyl]-1,3-thiazol-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]-1,3,4-oxadiazole (PubChem CID 163803352) has the molecular formula C25H24N6OS and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-methyl-5-[2-[5-[(4-pyrazol-1-ylcyclohexa-1,3-dien-1-yl)methyl]-1,3-thiazol-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-[2-[5-[(4-pyrazol-1-ylcyclohexa-1,3-dien-1-yl)methyl]-1,3-thiazol-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 163803352 |
| Molecular Formula | C25H24N6OS |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-methyl-5-[2-[5-[(4-pyrazol-1-ylcyclohexa-1,3-dien-1-yl)methyl]-1,3-thiazol-2-yl]-3,4-dihydro-1H-isoquinolin-7-yl]-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2ccc3c(c2)CN(c2ncc(CC4=CC=C(n5cccn5)CC4)s2)CC3)o1 |
| InChI | InChI=1S/C25H24N6OS/c1-17-28-29-24(32-17)20-6-5-19-9-12-30(16-21(19)14-20)25-26-15-23(33-25)13-18-3-7-22(8-4-18)31-11-2-10-27-31/h2-3,5-7,10-11,14-15H,4,8-9,12-13,16H2,1H3 |
| InChIKey | NGWQLXFNHKHAPL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |