C35H38N6O4 — CID 163803573
tert-butyl 7-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-5-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethylamino]-4-methyl-2,3-dihydro-1-benzazepine-1-carboxylate (PubChem CID 163803573) has the molecular formula C35H38N6O4 and a molecular weight of 606.73 g/mol. Its IUPAC name is tert-butyl 7-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-5-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethylamino]-4-methyl-2,3-dihydro-1-benzazepine-1-carboxylate.
| Compound Name | tert-butyl 7-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-5-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethylamino]-4-methyl-2,3-dihydro-1-benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 163803573 |
| Molecular Formula | C35H38N6O4 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | tert-butyl 7-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)-5-[2-(1,3-dioxo-4,5-dihydroisoindol-2-yl)ethylamino]-4-methyl-2,3-dihydro-1-benzazepine-1-carboxylate |
| SMILES | CC1=C(NCCN2C(=O)C3=C(CCC=C3)C2=O)c2cc(C3C(C#N)=C(C)NC(C)=C3C#N)ccc2N(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C35H38N6O4/c1-20-13-15-40(34(44)45-35(4,5)6)29-12-11-23(30-27(18-36)21(2)39-22(3)28(30)19-37)17-26(29)31(20)38-14-16-41-32(42)24-9-7-8-10-25(24)33(41)43/h7,9,11-12,17,30,38-39H,8,10,13-16H2,1-6H3 |
| InChIKey | NHBDBJZPYDRANB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 138.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|