C19H25N — CID 163804278
N-(3,5-dimethylphenyl)-N,2,3,5,6-pentamethylaniline (PubChem CID 163804278) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N,2,3,5,6-pentamethylaniline.
| Compound Name | N-(3,5-dimethylphenyl)-N,2,3,5,6-pentamethylaniline |
|---|---|
| PubChem CID | 163804278 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N,2,3,5,6-pentamethylaniline |
| SMILES | Cc1cc(C)cc(N(C)c2c(C)c(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C19H25N/c1-12-8-13(2)10-18(9-12)20(7)19-16(5)14(3)11-15(4)17(19)6/h8-11H,1-7H3 |
| InChIKey | ITCFYSVJYAYHJN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |